C45H42N4O7 — CID 6683329
benzyl N-[1-[[2-[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6683329) has the molecular formula C45H42N4O7 and a molecular weight of 750.85 g/mol. Its IUPAC name is benzyl N-[1-[[2-[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[2-[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6683329 |
| Molecular Formula | C45H42N4O7 |
| Molecular Weight | 750.85 g/mol |
| Exact Mass | 750.31 |
| IUPAC Name | benzyl N-[1-[[2-[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | C[C@H]1[C@@H](Cn2cnc3ccccc32)O[C@@H](c2ccc(-c3ccccc3CN3C(=O)CC(NC(=O)OCc4ccccc4)C3=O)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C45H42N4O7/c1-29-40(25-48-28-46-37-13-7-8-14-39(37)48)55-44(56-42(29)33-17-15-30(26-50)16-18-33)34-21-19-32(20-22-34)36-12-6-5-11-35(36)24-49-41(51)23-38(43(49)52)47-45(53)54-27-31-9-3-2-4-10-31/h2-22,28-29,38,40,42,44,50H,23-27H2,1H3,(H,47,53)/t29-,38?,40+,42+,44+/m0/s1 |
| InChIKey | RWYTZAZETYYCPD-FBEWNCPESA-N |
| XLogP | 7.24 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.85 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|