About 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone
1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone (PubChem CID 66834859) has the molecular formula C21H20BrNO2
and a molecular weight of 398.30 g/mol. Its IUPAC name is 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone |
| PubChem CID | 66834859 |
| Molecular Formula | C21H20BrNO2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone |
| SMILES | COc1cc2c(cc1C(C)=O)Cc1c([nH]c3cccc(Br)c13)C2(C)C |
| InChI | InChI=1S/C21H20BrNO2/c1-11(24)13-8-12-9-14-19-16(22)6-5-7-17(19)23-20(14)21(2,3)15(12)10-18(13)25-4/h5-8,10,23H,9H2,1-4H3 |
| InChIKey | XIBGDZYTDLSKLR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone?
The IUPAC name of 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone (CID 66834859) is 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone.
What is the SMILES notation for 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone?
The canonical SMILES for 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone is COc1cc2c(cc1C(C)=O)Cc1c([nH]c3cccc(Br)c13)C2(C)C.
What is the InChIKey of 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone?
The InChIKey is XIBGDZYTDLSKLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20BrNO2/c1-11(24)13-8-12-9-14-19-16(22)6-5-7-17(19)23-20(14)21(2,3)15(12)10-18(13)25-4/h5-8,10,23H,9H2,1-4H3.
What are the key properties of 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone?
1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone has a molecular weight of 398.30 g/mol, XLogP of 5.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-bromo-8-methoxy-6,6-dimethyl-5,11-dihydrobenzo[b]carbazol-9-yl)ethanone is sourced from PubChem (CID 66834859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).