C17H20BrNO3 — CID 90723696
(5-bromo-1-butyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl) acetate (PubChem CID 90723696) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is (5-bromo-1-butyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl) acetate.
| Compound Name | (5-bromo-1-butyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl) acetate |
|---|---|
| PubChem CID | 90723696 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (5-bromo-1-butyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl) acetate |
| SMILES | CCCCC1(OC(C)=O)OCCc2c1[nH]c1cccc(Br)c21 |
| InChI | InChI=1S/C17H20BrNO3/c1-3-4-9-17(22-11(2)20)16-12(8-10-21-17)15-13(18)6-5-7-14(15)19-16/h5-7,19H,3-4,8-10H2,1-2H3 |
| InChIKey | XLORVCURVXJXKE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |