C17H16ClF2N3O — CID 66835574
4-chloro-4,4-difluoro-1-(4-quinolin-4-ylpiperazin-1-yl)but-2-en-1-one (PubChem CID 66835574) has the molecular formula C17H16ClF2N3O and a molecular weight of 351.78 g/mol. Its IUPAC name is 4-chloro-4,4-difluoro-1-(4-quinolin-4-ylpiperazin-1-yl)but-2-en-1-one.
| Compound Name | 4-chloro-4,4-difluoro-1-(4-quinolin-4-ylpiperazin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 66835574 |
| Molecular Formula | C17H16ClF2N3O |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-chloro-4,4-difluoro-1-(4-quinolin-4-ylpiperazin-1-yl)but-2-en-1-one |
| SMILES | O=C(C=CC(F)(F)Cl)N1CCN(c2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C17H16ClF2N3O/c18-17(19,20)7-5-16(24)23-11-9-22(10-12-23)15-6-8-21-14-4-2-1-3-13(14)15/h1-8H,9-12H2 |
| InChIKey | YFXPHAFXVBMAOM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|