C16H29BN2O5 — CID 66838359
2,3-dimethylbutane-2,3-diol;[4-(ethylcarbamoylamino)-3-methylphenyl]boronic acid (PubChem CID 66838359) has the molecular formula C16H29BN2O5 and a molecular weight of 340.23 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;[4-(ethylcarbamoylamino)-3-methylphenyl]boronic acid.
| Compound Name | 2,3-dimethylbutane-2,3-diol;[4-(ethylcarbamoylamino)-3-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 66838359 |
| Molecular Formula | C16H29BN2O5 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;[4-(ethylcarbamoylamino)-3-methylphenyl]boronic acid |
| SMILES | CC(C)(O)C(C)(C)O.CCNC(=O)Nc1ccc(B(O)O)cc1C |
| InChI | InChI=1S/C10H15BN2O3.C6H14O2/c1-3-12-10(14)13-9-5-4-8(11(15)16)6-7(9)2;1-5(2,7)6(3,4)8/h4-6,15-16H,3H2,1-2H3,(H2,12,13,14);7-8H,1-4H3 |
| InChIKey | IPEKAEUZUGRHHJ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|