C31H53NO5Si — CID 66844848
tert-butyl 4-[4-(3-methoxypropoxy)-2-[2-tri(propan-2-yl)silyloxyethyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 66844848) has the molecular formula C31H53NO5Si and a molecular weight of 547.85 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-methoxypropoxy)-2-[2-tri(propan-2-yl)silyloxyethyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-methoxypropoxy)-2-[2-tri(propan-2-yl)silyloxyethyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 66844848 |
| Molecular Formula | C31H53NO5Si |
| Molecular Weight | 547.85 g/mol |
| Exact Mass | 547.37 |
| IUPAC Name | tert-butyl 4-[4-(3-methoxypropoxy)-2-[2-tri(propan-2-yl)silyloxyethyl]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COCCCOc1ccc(C2=CCN(C(=O)OC(C)(C)C)CC2)c(CCO[Si](C(C)C)(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C31H53NO5Si/c1-23(2)38(24(3)4,25(5)6)36-21-16-27-22-28(35-20-11-19-34-10)12-13-29(27)26-14-17-32(18-15-26)30(33)37-31(7,8)9/h12-14,22-25H,11,15-21H2,1-10H3 |
| InChIKey | HHXRSVWNDGBWED-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.85 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|