C34H43N3O5S — CID 6684515
N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide (PubChem CID 6684515) has the molecular formula C34H43N3O5S and a molecular weight of 605.80 g/mol. Its IUPAC name is N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6684515 |
| Molecular Formula | C34H43N3O5S |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[(2S)-2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methyl]-1,3-dioxan-2-yl]phenyl]benzenesulfonamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(NS(=O)(=O)c3ccccc3)c2)O[C@@H]1CN1CCC[C@H]1CN1CCCC1 |
| InChI | InChI=1S/C34H43N3O5S/c1-25-32(23-37-20-8-11-30(37)22-36-18-5-6-19-36)41-34(42-33(25)27-16-14-26(24-38)15-17-27)28-9-7-10-29(21-28)35-43(39,40)31-12-3-2-4-13-31/h2-4,7,9-10,12-17,21,25,30,32-35,38H,5-6,8,11,18-20,22-24H2,1H3/t25-,30-,32+,33?,34+/m0/s1 |
| InChIKey | ZEADMOSWGACWDX-KRSCOUFISA-N |
| XLogP | 5.33 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |