C33H33N3O8S2 — CID 66846186
4-(cyclopropylmethoxy)-N-[6-[[(1,1-dioxothian-4-yl)-(2-nitrophenyl)sulfonylamino]methyl]naphthalen-2-yl]benzamide (PubChem CID 66846186) has the molecular formula C33H33N3O8S2 and a molecular weight of 663.77 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-N-[6-[[(1,1-dioxothian-4-yl)-(2-nitrophenyl)sulfonylamino]methyl]naphthalen-2-yl]benzamide.
| Compound Name | 4-(cyclopropylmethoxy)-N-[6-[[(1,1-dioxothian-4-yl)-(2-nitrophenyl)sulfonylamino]methyl]naphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 66846186 |
| Molecular Formula | C33H33N3O8S2 |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.17 |
| IUPAC Name | 4-(cyclopropylmethoxy)-N-[6-[[(1,1-dioxothian-4-yl)-(2-nitrophenyl)sulfonylamino]methyl]naphthalen-2-yl]benzamide |
| SMILES | O=C(Nc1ccc2cc(CN(C3CCS(=O)(=O)CC3)S(=O)(=O)c3ccccc3[N+](=O)[O-])ccc2c1)c1ccc(OCC2CC2)cc1 |
| InChI | InChI=1S/C33H33N3O8S2/c37-33(25-10-13-30(14-11-25)44-22-23-5-6-23)34-28-12-9-26-19-24(7-8-27(26)20-28)21-35(29-15-17-45(40,41)18-16-29)46(42,43)32-4-2-1-3-31(32)36(38)39/h1-4,7-14,19-20,23,29H,5-6,15-18,21-22H2,(H,34,37) |
| InChIKey | BJLHMIBFIOTYOE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|