C19H16N2O2 — CID 668465
methyl 4-(2,3-dihydro-1H-perimidin-2-yl)benzoate (PubChem CID 668465) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl 4-(2,3-dihydro-1H-perimidin-2-yl)benzoate.
| Compound Name | methyl 4-(2,3-dihydro-1H-perimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 668465 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl 4-(2,3-dihydro-1H-perimidin-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2Nc3cccc4cccc(c34)N2)cc1 |
| InChI | InChI=1S/C19H16N2O2/c1-23-19(22)14-10-8-13(9-11-14)18-20-15-6-2-4-12-5-3-7-16(21-18)17(12)15/h2-11,18,20-21H,1H3 |
| InChIKey | SJKNLGFGOFDDJI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|