C22H21N3O3 — CID 54580397
methyl 4-[[4-(phenylcarbamoylamino)anilino]methyl]benzoate (PubChem CID 54580397) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is methyl 4-[[4-(phenylcarbamoylamino)anilino]methyl]benzoate.
| Compound Name | methyl 4-[[4-(phenylcarbamoylamino)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 54580397 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | methyl 4-[[4-(phenylcarbamoylamino)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2ccc(NC(=O)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O3/c1-28-21(26)17-9-7-16(8-10-17)15-23-18-11-13-20(14-12-18)25-22(27)24-19-5-3-2-4-6-19/h2-14,23H,15H2,1H3,(H2,24,25,27) |
| InChIKey | VTUMSSWZEFTCDU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |