C17H24N4O2Si — CID 66850663
3-[4-amino-1-[2-(trimethylsilylmethoxy)ethyl]pyrazol-5-yl]-4-methoxybenzonitrile (PubChem CID 66850663) has the molecular formula C17H24N4O2Si and a molecular weight of 344.49 g/mol. Its IUPAC name is 3-[4-amino-1-[2-(trimethylsilylmethoxy)ethyl]pyrazol-5-yl]-4-methoxybenzonitrile.
| Compound Name | 3-[4-amino-1-[2-(trimethylsilylmethoxy)ethyl]pyrazol-5-yl]-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 66850663 |
| Molecular Formula | C17H24N4O2Si |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-[4-amino-1-[2-(trimethylsilylmethoxy)ethyl]pyrazol-5-yl]-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)cc1-c1c(N)cnn1CCOC[Si](C)(C)C |
| InChI | InChI=1S/C17H24N4O2Si/c1-22-16-6-5-13(10-18)9-14(16)17-15(19)11-20-21(17)7-8-23-12-24(2,3)4/h5-6,9,11H,7-8,12,19H2,1-4H3 |
| InChIKey | MGNMBHJNZWKJPP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|