C19H15NOS — CID 66851505
N,N-diphenyl-2-sulfanylbenzamide (PubChem CID 66851505) has the molecular formula C19H15NOS and a molecular weight of 305.40 g/mol. Its IUPAC name is N,N-diphenyl-2-sulfanylbenzamide.
| Compound Name | N,N-diphenyl-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 66851505 |
| Molecular Formula | C19H15NOS |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N,N-diphenyl-2-sulfanylbenzamide |
| SMILES | O=C(c1ccccc1S)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H15NOS/c21-19(17-13-7-8-14-18(17)22)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,22H |
| InChIKey | GOIWFQZTMMWNMA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|