C24H28N4O2S — CID 66852277
(2R)-2-(4-methylpiperazin-1-yl)-2-[1-(4-propan-2-ylphenyl)sulfonylindol-3-yl]acetonitrile (PubChem CID 66852277) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is (2R)-2-(4-methylpiperazin-1-yl)-2-[1-(4-propan-2-ylphenyl)sulfonylindol-3-yl]acetonitrile.
| Compound Name | (2R)-2-(4-methylpiperazin-1-yl)-2-[1-(4-propan-2-ylphenyl)sulfonylindol-3-yl]acetonitrile |
|---|---|
| PubChem CID | 66852277 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2R)-2-(4-methylpiperazin-1-yl)-2-[1-(4-propan-2-ylphenyl)sulfonylindol-3-yl]acetonitrile |
| SMILES | CC(C)c1ccc(S(=O)(=O)n2cc([C@H](C#N)N3CCN(C)CC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H28N4O2S/c1-18(2)19-8-10-20(11-9-19)31(29,30)28-17-22(21-6-4-5-7-23(21)28)24(16-25)27-14-12-26(3)13-15-27/h4-11,17-18,24H,12-15H2,1-3H3/t24-/m0/s1 |
| InChIKey | GKJFEJXFQPSRMV-DEOSSOPVSA-N |
| XLogP | 3.81 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |