4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid

C10H5Br2ClN2O2 — CID 66854245

IUPAC4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid
SMILESO=C(O)c1cc(Br)c(Br)n1-c1ncccc1Cl
InChIInChI=1S/C10H5Br2ClN2O2/c11-5-4-7(10(16)17)15(8(5)12)9-6(13)2-1-3-14-9/h1-4H,(H,16,17)
InChIKeyNPOCJECLWXPMTC-UHFFFAOYSA-N
MW380.42 g/mol
LogP3.75
Rot. Bonds2

About 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid

4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid (PubChem CID 66854245) has the molecular formula C10H5Br2ClN2O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid.

Molecular Properties

Compound Name4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid
PubChem CID66854245
Molecular FormulaC10H5Br2ClN2O2
Molecular Weight380.42 g/mol
Exact Mass377.84
IUPAC Name4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid
SMILESO=C(O)c1cc(Br)c(Br)n1-c1ncccc1Cl
InChIInChI=1S/C10H5Br2ClN2O2/c11-5-4-7(10(16)17)15(8(5)12)9-6(13)2-1-3-14-9/h1-4H,(H,16,17)
InChIKeyNPOCJECLWXPMTC-UHFFFAOYSA-N
XLogP3.75
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500380.42
LogP ≤ 53.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid?
The IUPAC name of 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid (CID 66854245) is 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid.
What is the SMILES notation for 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid?
The canonical SMILES for 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid is O=C(O)c1cc(Br)c(Br)n1-c1ncccc1Cl.
What is the InChIKey of 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid?
The InChIKey is NPOCJECLWXPMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Br2ClN2O2/c11-5-4-7(10(16)17)15(8(5)12)9-6(13)2-1-3-14-9/h1-4H,(H,16,17).
What are the key properties of 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid?
4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid has a molecular weight of 380.42 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibromo-1-(3-chloro-2-pyridinyl)pyrrole-2-carboxylic acid is sourced from PubChem (CID 66854245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).