C17H10Br3Cl2N5O2 — CID 66854373
4-bromo-5-chloro-1-(3-chloro-2-pyridinyl)-N-[2,4-dibromo-6-(hydrazinecarbonyl)phenyl]pyrrole-2-carboxamide (PubChem CID 66854373) has the molecular formula C17H10Br3Cl2N5O2 and a molecular weight of 626.92 g/mol. Its IUPAC name is 4-bromo-5-chloro-1-(3-chloro-2-pyridinyl)-N-[2,4-dibromo-6-(hydrazinecarbonyl)phenyl]pyrrole-2-carboxamide.
| Compound Name | 4-bromo-5-chloro-1-(3-chloro-2-pyridinyl)-N-[2,4-dibromo-6-(hydrazinecarbonyl)phenyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66854373 |
| Molecular Formula | C17H10Br3Cl2N5O2 |
| Molecular Weight | 626.92 g/mol |
| Exact Mass | 622.78 |
| IUPAC Name | 4-bromo-5-chloro-1-(3-chloro-2-pyridinyl)-N-[2,4-dibromo-6-(hydrazinecarbonyl)phenyl]pyrrole-2-carboxamide |
| SMILES | NNC(=O)c1cc(Br)cc(Br)c1NC(=O)c1cc(Br)c(Cl)n1-c1ncccc1Cl |
| InChI | InChI=1S/C17H10Br3Cl2N5O2/c18-7-4-8(16(28)26-23)13(9(19)5-7)25-17(29)12-6-10(20)14(22)27(12)15-11(21)2-1-3-24-15/h1-6H,23H2,(H,25,29)(H,26,28) |
| InChIKey | GYMQMDUCSRAVCQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.92 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|