C20H16Br2ClN5O4S — CID 59286872
methyl N-[[3,5-dibromo-2-[[1-(3-chloro-2-pyridinyl)-5-methylsulfanylpyrrole-2-carbonyl]amino]benzoyl]amino]carbamate (PubChem CID 59286872) has the molecular formula C20H16Br2ClN5O4S and a molecular weight of 617.71 g/mol. Its IUPAC name is methyl N-[[3,5-dibromo-2-[[1-(3-chloro-2-pyridinyl)-5-methylsulfanylpyrrole-2-carbonyl]amino]benzoyl]amino]carbamate.
| Compound Name | methyl N-[[3,5-dibromo-2-[[1-(3-chloro-2-pyridinyl)-5-methylsulfanylpyrrole-2-carbonyl]amino]benzoyl]amino]carbamate |
|---|---|
| PubChem CID | 59286872 |
| Molecular Formula | C20H16Br2ClN5O4S |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 614.90 |
| IUPAC Name | methyl N-[[3,5-dibromo-2-[[1-(3-chloro-2-pyridinyl)-5-methylsulfanylpyrrole-2-carbonyl]amino]benzoyl]amino]carbamate |
| SMILES | COC(=O)NNC(=O)c1cc(Br)cc(Br)c1NC(=O)c1ccc(SC)n1-c1ncccc1Cl |
| InChI | InChI=1S/C20H16Br2ClN5O4S/c1-32-20(31)27-26-18(29)11-8-10(21)9-12(22)16(11)25-19(30)14-5-6-15(33-2)28(14)17-13(23)4-3-7-24-17/h3-9H,1-2H3,(H,25,30)(H,26,29)(H,27,31) |
| InChIKey | AFVJFPTUPZQXOR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|