C21H18Br3ClN6O4 — CID 89488386
[[3,5-dibromo-2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]benzoyl]-ethylamino]-ethylcarbamic acid (PubChem CID 89488386) has the molecular formula C21H18Br3ClN6O4 and a molecular weight of 693.58 g/mol. Its IUPAC name is [[3,5-dibromo-2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]benzoyl]-ethylamino]-ethylcarbamic acid.
| Compound Name | [[3,5-dibromo-2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]benzoyl]-ethylamino]-ethylcarbamic acid |
|---|---|
| PubChem CID | 89488386 |
| Molecular Formula | C21H18Br3ClN6O4 |
| Molecular Weight | 693.58 g/mol |
| Exact Mass | 689.86 |
| IUPAC Name | [[3,5-dibromo-2-[[3-bromo-1-(3-chloro-2-pyridinyl)pyrazole-5-carbonyl]amino]benzoyl]-ethylamino]-ethylcarbamic acid |
| SMILES | CCN(C(=O)O)N(CC)C(=O)c1cc(Br)cc(Br)c1NC(=O)c1cc(Br)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C21H18Br3ClN6O4/c1-3-29(30(4-2)21(34)35)20(33)12-8-11(22)9-13(23)17(12)27-19(32)15-10-16(24)28-31(15)18-14(25)6-5-7-26-18/h5-10H,3-4H2,1-2H3,(H,27,32)(H,34,35) |
| InChIKey | MQEIRDUPXBZEGB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|