C19H13Br2ClF3N5O2S — CID 72547850
1-(3-chloro-2-pyridinyl)-N-[2,4-dibromo-6-(ethylsulfanylcarbamoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 72547850) has the molecular formula C19H13Br2ClF3N5O2S and a molecular weight of 627.67 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-N-[2,4-dibromo-6-(ethylsulfanylcarbamoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(3-chloro-2-pyridinyl)-N-[2,4-dibromo-6-(ethylsulfanylcarbamoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 72547850 |
| Molecular Formula | C19H13Br2ClF3N5O2S |
| Molecular Weight | 627.67 g/mol |
| Exact Mass | 624.88 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-N-[2,4-dibromo-6-(ethylsulfanylcarbamoyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CCSNC(=O)c1cc(Br)cc(Br)c1NC(=O)c1cc(C(F)(F)F)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C19H13Br2ClF3N5O2S/c1-2-33-29-17(31)10-6-9(20)7-11(21)15(10)27-18(32)13-8-14(19(23,24)25)28-30(13)16-12(22)4-3-5-26-16/h3-8H,2H2,1H3,(H,27,32)(H,29,31) |
| InChIKey | RXRVIXHJUBYBIG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|