C27H33F5N2O3S — CID 66855782
3-[2,6-dibutyl-4-(trifluoromethyl)phenyl]-N-[1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]prop-2-enamide (PubChem CID 66855782) has the molecular formula C27H33F5N2O3S and a molecular weight of 560.63 g/mol. Its IUPAC name is 3-[2,6-dibutyl-4-(trifluoromethyl)phenyl]-N-[1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]prop-2-enamide.
| Compound Name | 3-[2,6-dibutyl-4-(trifluoromethyl)phenyl]-N-[1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 66855782 |
| Molecular Formula | C27H33F5N2O3S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 3-[2,6-dibutyl-4-(trifluoromethyl)phenyl]-N-[1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]prop-2-enamide |
| SMILES | CCCCc1cc(C(F)(F)F)cc(CCCC)c1C=CC(=O)NC(C)c1cc(F)c(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C27H33F5N2O3S/c1-5-7-9-18-13-21(27(30,31)32)14-19(10-8-6-2)22(18)11-12-25(35)33-17(3)20-15-23(28)26(24(29)16-20)34-38(4,36)37/h11-17,34H,5-10H2,1-4H3,(H,33,35) |
| InChIKey | LQQPUJGDKNAHGV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|