C23H29FN2O5S — CID 66856319
N-[3-[6-(4-fluorophenyl)-3-[(1S)-1-(4-methoxyphenyl)ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl]methanesulfonamide (PubChem CID 66856319) has the molecular formula C23H29FN2O5S and a molecular weight of 464.56 g/mol. Its IUPAC name is N-[3-[6-(4-fluorophenyl)-3-[(1S)-1-(4-methoxyphenyl)ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[6-(4-fluorophenyl)-3-[(1S)-1-(4-methoxyphenyl)ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 66856319 |
| Molecular Formula | C23H29FN2O5S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[3-[6-(4-fluorophenyl)-3-[(1S)-1-(4-methoxyphenyl)ethyl]-2-oxo-1,3-oxazinan-6-yl]propyl]methanesulfonamide |
| SMILES | COc1ccc([C@H](C)N2CCC(CCCNS(C)(=O)=O)(c3ccc(F)cc3)OC2=O)cc1 |
| InChI | InChI=1S/C23H29FN2O5S/c1-17(18-5-11-21(30-2)12-6-18)26-16-14-23(31-22(26)27,13-4-15-25-32(3,28)29)19-7-9-20(24)10-8-19/h5-12,17,25H,4,13-16H2,1-3H3/t17-,23?/m0/s1 |
| InChIKey | OKTFLOUVCVASEX-NVHKAFQKSA-N |
| XLogP | 3.96 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|