C28H31FN2O4S — CID 91603450
N-[3-[3-[1-[4-(4-fluorophenyl)phenyl]ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propyl]methanesulfonamide (PubChem CID 91603450) has the molecular formula C28H31FN2O4S and a molecular weight of 510.63 g/mol. Its IUPAC name is N-[3-[3-[1-[4-(4-fluorophenyl)phenyl]ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[3-[1-[4-(4-fluorophenyl)phenyl]ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 91603450 |
| Molecular Formula | C28H31FN2O4S |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | N-[3-[3-[1-[4-(4-fluorophenyl)phenyl]ethyl]-2-oxo-6-phenyl-1,3-oxazinan-6-yl]propyl]methanesulfonamide |
| SMILES | CC(c1ccc(-c2ccc(F)cc2)cc1)N1CCC(CCCNS(C)(=O)=O)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C28H31FN2O4S/c1-21(22-9-11-23(12-10-22)24-13-15-26(29)16-14-24)31-20-18-28(35-27(31)32,25-7-4-3-5-8-25)17-6-19-30-36(2,33)34/h3-5,7-16,21,30H,6,17-20H2,1-2H3 |
| InChIKey | BQCXLHLPSDTZNI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|