C22H21F4NO3 — CID 66857713
(6R)-6-(4-fluorophenyl)-6-prop-2-enyl-3-[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]-1,3-oxazinan-2-one (PubChem CID 66857713) has the molecular formula C22H21F4NO3 and a molecular weight of 423.41 g/mol. Its IUPAC name is (6R)-6-(4-fluorophenyl)-6-prop-2-enyl-3-[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]-1,3-oxazinan-2-one.
| Compound Name | (6R)-6-(4-fluorophenyl)-6-prop-2-enyl-3-[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 66857713 |
| Molecular Formula | C22H21F4NO3 |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (6R)-6-(4-fluorophenyl)-6-prop-2-enyl-3-[(1S)-1-[4-(trifluoromethoxy)phenyl]ethyl]-1,3-oxazinan-2-one |
| SMILES | C=CC[C@]1(c2ccc(F)cc2)CCN([C@@H](C)c2ccc(OC(F)(F)F)cc2)C(=O)O1 |
| InChI | InChI=1S/C22H21F4NO3/c1-3-12-21(17-6-8-18(23)9-7-17)13-14-27(20(28)30-21)15(2)16-4-10-19(11-5-16)29-22(24,25)26/h3-11,15H,1,12-14H2,2H3/t15-,21+/m0/s1 |
| InChIKey | CPLRAYMPDNEKIE-YCRPNKLZSA-N |
| XLogP | 6.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|