C22H23FN2O3 — CID 68726030
4-[1-[6-(4-fluorophenyl)-2-oxo-6-prop-2-enyl-1,3-oxazinan-3-yl]ethyl]benzamide (PubChem CID 68726030) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-[1-[6-(4-fluorophenyl)-2-oxo-6-prop-2-enyl-1,3-oxazinan-3-yl]ethyl]benzamide.
| Compound Name | 4-[1-[6-(4-fluorophenyl)-2-oxo-6-prop-2-enyl-1,3-oxazinan-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 68726030 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-[1-[6-(4-fluorophenyl)-2-oxo-6-prop-2-enyl-1,3-oxazinan-3-yl]ethyl]benzamide |
| SMILES | C=CCC1(c2ccc(F)cc2)CCN(C(C)c2ccc(C(N)=O)cc2)C(=O)O1 |
| InChI | InChI=1S/C22H23FN2O3/c1-3-12-22(18-8-10-19(23)11-9-18)13-14-25(21(27)28-22)15(2)16-4-6-17(7-5-16)20(24)26/h3-11,15H,1,12-14H2,2H3,(H2,24,26) |
| InChIKey | UMZCDOIEKIXFIV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|