C23H17ClFN3O3 — CID 66858047
methyl 4-[[1-[(3-chlorophenyl)methyl]-6-fluoroindazol-3-yl]carbamoyl]benzoate (PubChem CID 66858047) has the molecular formula C23H17ClFN3O3 and a molecular weight of 437.86 g/mol. Its IUPAC name is methyl 4-[[1-[(3-chlorophenyl)methyl]-6-fluoroindazol-3-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[1-[(3-chlorophenyl)methyl]-6-fluoroindazol-3-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 66858047 |
| Molecular Formula | C23H17ClFN3O3 |
| Molecular Weight | 437.86 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | methyl 4-[[1-[(3-chlorophenyl)methyl]-6-fluoroindazol-3-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2nn(Cc3cccc(Cl)c3)c3cc(F)ccc23)cc1 |
| InChI | InChI=1S/C23H17ClFN3O3/c1-31-23(30)16-7-5-15(6-8-16)22(29)26-21-19-10-9-18(25)12-20(19)28(27-21)13-14-3-2-4-17(24)11-14/h2-12H,13H2,1H3,(H,26,27,29) |
| InChIKey | INJPJGGJDHKGKX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.86 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |