C19H16ClN4O2+ — CID 123635821
N-[1-[(4-chlorophenyl)methyl]indazol-3-yl]-3-methyl-1,3-oxazol-3-ium-4-carboxamide (PubChem CID 123635821) has the molecular formula C19H16ClN4O2+ and a molecular weight of 367.82 g/mol. Its IUPAC name is N-[1-[(4-chlorophenyl)methyl]indazol-3-yl]-3-methyl-1,3-oxazol-3-ium-4-carboxamide.
| Compound Name | N-[1-[(4-chlorophenyl)methyl]indazol-3-yl]-3-methyl-1,3-oxazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 123635821 |
| Molecular Formula | C19H16ClN4O2+ |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[1-[(4-chlorophenyl)methyl]indazol-3-yl]-3-methyl-1,3-oxazol-3-ium-4-carboxamide |
| SMILES | C[n+]1cocc1C(=O)Nc1nn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C19H15ClN4O2/c1-23-12-26-11-17(23)19(25)21-18-15-4-2-3-5-16(15)24(22-18)10-13-6-8-14(20)9-7-13/h2-9,11-12H,10H2,1H3/p+1 |
| InChIKey | ODXFEBFOJSNUPE-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|