C24H20N4O3S — CID 126475209
N-[1-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]methyl]indazol-3-yl]thiophene-2-carboxamide (PubChem CID 126475209) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is N-[1-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]methyl]indazol-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]methyl]indazol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126475209 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[1-[[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]methyl]indazol-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1nn(Cc2ccc(CN3C(=O)CCC3=O)cc2)c2ccccc12)c1cccs1 |
| InChI | InChI=1S/C24H20N4O3S/c29-21-11-12-22(30)27(21)14-16-7-9-17(10-8-16)15-28-19-5-2-1-4-18(19)23(26-28)25-24(31)20-6-3-13-32-20/h1-10,13H,11-12,14-15H2,(H,25,26,31) |
| InChIKey | HPWWBWMMXTUDAW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|