C10H18N2O — CID 66858310
(1S,4R)-4-(morpholin-4-ylmethyl)cyclopent-2-en-1-amine (PubChem CID 66858310) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (1S,4R)-4-(morpholin-4-ylmethyl)cyclopent-2-en-1-amine.
| Compound Name | (1S,4R)-4-(morpholin-4-ylmethyl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 66858310 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (1S,4R)-4-(morpholin-4-ylmethyl)cyclopent-2-en-1-amine |
| SMILES | N[C@@H]1C=C[C@H](CN2CCOCC2)C1 |
| InChI | InChI=1S/C10H18N2O/c11-10-2-1-9(7-10)8-12-3-5-13-6-4-12/h1-2,9-10H,3-8,11H2/t9-,10+/m0/s1 |
| InChIKey | GNFZGGSEKSXXPZ-VHSXEESVSA-N |
| XLogP | 0.22 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|