C22H30N4O4S — CID 66859224
(E)-3-[5-(6-methoxy-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide (PubChem CID 66859224) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is (E)-3-[5-(6-methoxy-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | (E)-3-[5-(6-methoxy-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 66859224 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (E)-3-[5-(6-methoxy-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)/C=C/c1c(C)nn(C)c1N1CCc2ccc(OC)cc21 |
| InChI | InChI=1S/C22H30N4O4S/c1-5-6-7-14-31(28,29)24-21(27)11-10-19-16(2)23-25(3)22(19)26-13-12-17-8-9-18(30-4)15-20(17)26/h8-11,15H,5-7,12-14H2,1-4H3,(H,24,27)/b11-10+ |
| InChIKey | MPPDGXYGKJEWCL-ZHACJKMWSA-N |
| XLogP | 3.08 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|