C46H46N2O4 — CID 6685960
N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6685960) has the molecular formula C46H46N2O4 and a molecular weight of 690.88 g/mol. Its IUPAC name is N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6685960 |
| Molecular Formula | C46H46N2O4 |
| Molecular Weight | 690.88 g/mol |
| Exact Mass | 690.35 |
| IUPAC Name | N-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | C[C@H]1[C@@H](CN(C)[C@H](C)c2ccc3ccccc3c2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)c3ccccc3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C46H46N2O4/c1-31-43(29-48(3)32(2)39-26-21-34-11-7-8-14-40(34)27-39)51-46(52-44(31)36-19-17-33(30-49)18-20-36)38-24-22-35(23-25-38)42-16-10-9-15-41(42)28-47-45(50)37-12-5-4-6-13-37/h4-27,31-32,43-44,46,49H,28-30H2,1-3H3,(H,47,50)/t31-,32+,43+,44+,46+/m0/s1 |
| InChIKey | LAZHUKRUCXZNRF-SZAKRCRDSA-N |
| XLogP | 9.41 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.88 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |