C38H45N3O4 — CID 6689650
1-ethyl-3-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6689650) has the molecular formula C38H45N3O4 and a molecular weight of 607.80 g/mol. Its IUPAC name is 1-ethyl-3-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6689650 |
| Molecular Formula | C38H45N3O4 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | 1-ethyl-3-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | CCNC(=O)NCc1ccccc1-c1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN(C)[C@@H](C)c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C38H45N3O4/c1-5-39-38(43)40-23-33-13-9-10-14-34(33)30-19-21-32(22-20-30)37-44-35(24-41(4)27(3)29-11-7-6-8-12-29)26(2)36(45-37)31-17-15-28(25-42)16-18-31/h6-22,26-27,35-37,42H,5,23-25H2,1-4H3,(H2,39,40,43)/t26-,27+,35+,36?,37+/m1/s1 |
| InChIKey | OMOBJQKEDLVXCQ-ROTAZNNZSA-N |
| XLogP | 7.15 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |