C33H43N3O5 — CID 6685123
1-ethyl-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6685123) has the molecular formula C33H43N3O5 and a molecular weight of 561.72 g/mol. Its IUPAC name is 1-ethyl-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6685123 |
| Molecular Formula | C33H43N3O5 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | 1-ethyl-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | CCNC(=O)NCc1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CN(C)[C@H](C)[C@@H](O)c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C33H43N3O5/c1-5-34-33(39)35-19-24-11-17-28(18-12-24)32-40-29(20-36(4)23(3)30(38)26-9-7-6-8-10-26)22(2)31(41-32)27-15-13-25(21-37)14-16-27/h6-18,22-23,29-32,37-38H,5,19-21H2,1-4H3,(H2,34,35,39)/t22-,23+,29+,30+,31?,32+/m0/s1 |
| InChIKey | RRZQTRWFXCCQGU-PSHPKSPSSA-N |
| XLogP | 4.84 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |