C37H38N2O6 — CID 6704723
2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6704723) has the molecular formula C37H38N2O6 and a molecular weight of 606.72 g/mol. Its IUPAC name is 2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6704723 |
| Molecular Formula | C37H38N2O6 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C[C@H]1[C@@H](CN(C)[C@@H](C)[C@H](O)c2ccccc2)O[C@@H](c2ccc(N3C(=O)c4ccccc4C3=O)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C37H38N2O6/c1-23-32(21-38(3)24(2)33(41)26-9-5-4-6-10-26)44-37(45-34(23)27-15-13-25(22-40)14-16-27)28-17-19-29(20-18-28)39-35(42)30-11-7-8-12-31(30)36(39)43/h4-20,23-24,32-34,37,40-41H,21-22H2,1-3H3/t23-,24-,32+,33-,34+,37+/m0/s1 |
| InChIKey | PZJQFSZVKATQIP-VBVBFREMSA-N |
| XLogP | 5.82 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|