C25H29FN4O — CID 66861083
N-[2-[ethyl(methyl)amino]-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]-3-phenylbutanamide (PubChem CID 66861083) has the molecular formula C25H29FN4O and a molecular weight of 420.53 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)amino]-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]-3-phenylbutanamide.
| Compound Name | N-[2-[ethyl(methyl)amino]-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 66861083 |
| Molecular Formula | C25H29FN4O |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-[2-[ethyl(methyl)amino]-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]-3-phenylbutanamide |
| SMILES | CCN(C)c1nc(NCc2ccc(F)cc2)ccc1NC(=O)CC(C)c1ccccc1 |
| InChI | InChI=1S/C25H29FN4O/c1-4-30(3)25-22(28-24(31)16-18(2)20-8-6-5-7-9-20)14-15-23(29-25)27-17-19-10-12-21(26)13-11-19/h5-15,18H,4,16-17H2,1-3H3,(H,27,29)(H,28,31) |
| InChIKey | WYVRDPFVJNWEPG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |