C11H11F3N4O2 — CID 66861279
2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene;2,2,2-trifluoroacetic acid (PubChem CID 66861279) has the molecular formula C11H11F3N4O2 and a molecular weight of 288.23 g/mol. Its IUPAC name is 2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene;2,2,2-trifluoroacetic acid.
| Compound Name | 2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66861279 |
| Molecular Formula | C11H11F3N4O2 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cc2nc3c(cn2n1)CCNC3 |
| InChI | InChI=1S/C9H10N4.C2HF3O2/c1-3-10-5-8-7(1)6-13-9(12-8)2-4-11-13;3-2(4,5)1(6)7/h2,4,6,10H,1,3,5H2;(H,6,7) |
| InChIKey | TZSOGYKJFZPHMG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |