C5H13NO2 — CID 66862955
N,N-dimethylmethanamine;1,3-dioxetane (PubChem CID 66862955) has the molecular formula C5H13NO2 and a molecular weight of 119.16 g/mol. Its IUPAC name is N,N-dimethylmethanamine;1,3-dioxetane.
| Compound Name | N,N-dimethylmethanamine;1,3-dioxetane |
|---|---|
| PubChem CID | 66862955 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | N,N-dimethylmethanamine;1,3-dioxetane |
| SMILES | C1OCO1.CN(C)C |
| InChI | InChI=1S/C3H9N.C2H4O2/c1-4(2)3;1-3-2-4-1/h1-3H3;1-2H2 |
| InChIKey | BTGQKQJBHSNILA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |