C13H18N4O — CID 66864103
3-pentan-3-yl-5-prop-1-enyl-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 66864103) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-pentan-3-yl-5-prop-1-enyl-1H-imidazo[4,5-b]pyrazin-2-one.
| Compound Name | 3-pentan-3-yl-5-prop-1-enyl-1H-imidazo[4,5-b]pyrazin-2-one |
|---|---|
| PubChem CID | 66864103 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-pentan-3-yl-5-prop-1-enyl-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | CC=Cc1cnc2[nH]c(=O)n(C(CC)CC)c2n1 |
| InChI | InChI=1S/C13H18N4O/c1-4-7-9-8-14-11-12(15-9)17(13(18)16-11)10(5-2)6-3/h4,7-8,10H,5-6H2,1-3H3,(H,14,16,18) |
| InChIKey | WYRAXYZTIXGPNA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |