C41H35N5O6S — CID 6686430
2-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6686430) has the molecular formula C41H35N5O6S and a molecular weight of 725.83 g/mol. Its IUPAC name is 2-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6686430 |
| Molecular Formula | C41H35N5O6S |
| Molecular Weight | 725.83 g/mol |
| Exact Mass | 725.23 |
| IUPAC Name | 2-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@H]1[C@@H](CSc2nnnn2-c2ccc(O)cc2)O[C@@H](c2ccc(-c3ccccc3CN3C(=O)c4ccccc4C3=O)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C41H35N5O6S/c1-25-36(24-53-41-42-43-44-46(41)31-18-20-32(48)21-19-31)51-40(52-37(25)28-12-10-26(23-47)11-13-28)29-16-14-27(15-17-29)33-7-3-2-6-30(33)22-45-38(49)34-8-4-5-9-35(34)39(45)50/h2-21,25,36-37,40,47-48H,22-24H2,1H3/t25-,36+,37+,40+/m0/s1 |
| InChIKey | FOQXCFRCQOWMJG-KUUHTWJASA-N |
| XLogP | 6.91 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.83 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|