C16H19N5O — CID 66864946
N-pyridin-2-yl-2-(2-pyridin-4-ylpiperazin-1-yl)acetamide (PubChem CID 66864946) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is N-pyridin-2-yl-2-(2-pyridin-4-ylpiperazin-1-yl)acetamide.
| Compound Name | N-pyridin-2-yl-2-(2-pyridin-4-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 66864946 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-pyridin-2-yl-2-(2-pyridin-4-ylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCNCC1c1ccncc1)Nc1ccccn1 |
| InChI | InChI=1S/C16H19N5O/c22-16(20-15-3-1-2-6-19-15)12-21-10-9-18-11-14(21)13-4-7-17-8-5-13/h1-8,14,18H,9-12H2,(H,19,20,22) |
| InChIKey | BPCNQHSGPTWVPM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |