C31H34N2O2 — CID 66866480
tert-butyl 5-(1,3-dibenzylpyrrolidin-3-yl)indole-1-carboxylate (PubChem CID 66866480) has the molecular formula C31H34N2O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is tert-butyl 5-(1,3-dibenzylpyrrolidin-3-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 5-(1,3-dibenzylpyrrolidin-3-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 66866480 |
| Molecular Formula | C31H34N2O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | tert-butyl 5-(1,3-dibenzylpyrrolidin-3-yl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc2cc(C3(Cc4ccccc4)CCN(Cc4ccccc4)C3)ccc21 |
| InChI | InChI=1S/C31H34N2O2/c1-30(2,3)35-29(34)33-18-16-26-20-27(14-15-28(26)33)31(21-24-10-6-4-7-11-24)17-19-32(23-31)22-25-12-8-5-9-13-25/h4-16,18,20H,17,19,21-23H2,1-3H3 |
| InChIKey | LTTYZVYADFLTQV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |