About 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile
2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile (PubChem CID 66875329) has the molecular formula C19H21NO
and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile |
| PubChem CID | 66875329 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile |
| SMILES | Cc1cccc(C)c1COc1cccc(C(C)(C)C#N)c1 |
| InChI | InChI=1S/C19H21NO/c1-14-7-5-8-15(2)18(14)12-21-17-10-6-9-16(11-17)19(3,4)13-20/h5-11H,12H2,1-4H3 |
| InChIKey | LJMCAHGXGQEAMX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile?
The IUPAC name of 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile (CID 66875329) is 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile.
What is the SMILES notation for 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile?
The canonical SMILES for 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile is Cc1cccc(C)c1COc1cccc(C(C)(C)C#N)c1.
What is the InChIKey of 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile?
The InChIKey is LJMCAHGXGQEAMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO/c1-14-7-5-8-15(2)18(14)12-21-17-10-6-9-16(11-17)19(3,4)13-20/h5-11H,12H2,1-4H3.
What are the key properties of 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile?
2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile has a molecular weight of 279.38 g/mol, XLogP of 4.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(2,6-dimethylphenyl)methoxy]phenyl]-2-methylpropanenitrile is sourced from PubChem (CID 66875329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).