C23H29NO5 — CID 66875886
2-[3-[[3-(2-phenyl-1,3-dioxolan-2-yl)propylamino]methyl]phenoxy]butanoic acid (PubChem CID 66875886) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[3-[[3-(2-phenyl-1,3-dioxolan-2-yl)propylamino]methyl]phenoxy]butanoic acid.
| Compound Name | 2-[3-[[3-(2-phenyl-1,3-dioxolan-2-yl)propylamino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 66875886 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-[3-[[3-(2-phenyl-1,3-dioxolan-2-yl)propylamino]methyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1cccc(CNCCCC2(c3ccccc3)OCCO2)c1)C(=O)O |
| InChI | InChI=1S/C23H29NO5/c1-2-21(22(25)26)29-20-11-6-8-18(16-20)17-24-13-7-12-23(27-14-15-28-23)19-9-4-3-5-10-19/h3-6,8-11,16,21,24H,2,7,12-15,17H2,1H3,(H,25,26) |
| InChIKey | YEJUHTDHNQTDSS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|