C26H28ClN5O3 — CID 66876506
2-[2-[[4-[3-(4-chlorophenyl)prop-2-enoylamino]phenyl]methyl]-4,6-bis(dimethylamino)pyrimidin-5-yl]acetic acid (PubChem CID 66876506) has the molecular formula C26H28ClN5O3 and a molecular weight of 494.00 g/mol. Its IUPAC name is 2-[2-[[4-[3-(4-chlorophenyl)prop-2-enoylamino]phenyl]methyl]-4,6-bis(dimethylamino)pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[4-[3-(4-chlorophenyl)prop-2-enoylamino]phenyl]methyl]-4,6-bis(dimethylamino)pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 66876506 |
| Molecular Formula | C26H28ClN5O3 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 2-[2-[[4-[3-(4-chlorophenyl)prop-2-enoylamino]phenyl]methyl]-4,6-bis(dimethylamino)pyrimidin-5-yl]acetic acid |
| SMILES | CN(C)c1nc(Cc2ccc(NC(=O)C=Cc3ccc(Cl)cc3)cc2)nc(N(C)C)c1CC(=O)O |
| InChI | InChI=1S/C26H28ClN5O3/c1-31(2)25-21(16-24(34)35)26(32(3)4)30-22(29-25)15-18-7-12-20(13-8-18)28-23(33)14-9-17-5-10-19(27)11-6-17/h5-14H,15-16H2,1-4H3,(H,28,33)(H,34,35) |
| InChIKey | VIADXYASLLIBBI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|