C24H22ClN3O3S2 — CID 74411740
2-[2-[[4-[3-(4-chlorophenyl)prop-2-enoylamino]phenyl]methyl]-4,6-bis(methylsulfanyl)pyrimidin-5-yl]acetic acid (PubChem CID 74411740) has the molecular formula C24H22ClN3O3S2 and a molecular weight of 500.05 g/mol. Its IUPAC name is 2-[2-[[4-[3-(4-chlorophenyl)prop-2-enoylamino]phenyl]methyl]-4,6-bis(methylsulfanyl)pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[4-[3-(4-chlorophenyl)prop-2-enoylamino]phenyl]methyl]-4,6-bis(methylsulfanyl)pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 74411740 |
| Molecular Formula | C24H22ClN3O3S2 |
| Molecular Weight | 500.05 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 2-[2-[[4-[3-(4-chlorophenyl)prop-2-enoylamino]phenyl]methyl]-4,6-bis(methylsulfanyl)pyrimidin-5-yl]acetic acid |
| SMILES | CSc1nc(Cc2ccc(NC(=O)C=Cc3ccc(Cl)cc3)cc2)nc(SC)c1CC(=O)O |
| InChI | InChI=1S/C24H22ClN3O3S2/c1-32-23-19(14-22(30)31)24(33-2)28-20(27-23)13-16-5-10-18(11-6-16)26-21(29)12-7-15-3-8-17(25)9-4-15/h3-12H,13-14H2,1-2H3,(H,26,29)(H,30,31) |
| InChIKey | LXGYAPFYEMXNTD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.05 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|