C22H18ClN3NaO5 — CID 66877598
CID 66877598 (PubChem CID 66877598) has the molecular formula C22H18ClN3NaO5 and a molecular weight of 462.85 g/mol.
| Compound Name | CID 66877598 |
|---|---|
| PubChem CID | 66877598 |
| Molecular Formula | C22H18ClN3NaO5 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | — |
| SMILES | O=C(COCC(=O)Nc1ccc(Cl)cc1C(=O)O)Nc1cccc(-c2ccncc2)c1.[Na] |
| InChI | InChI=1S/C22H18ClN3O5.Na/c23-16-4-5-19(18(11-16)22(29)30)26-21(28)13-31-12-20(27)25-17-3-1-2-15(10-17)14-6-8-24-9-7-14;/h1-11H,12-13H2,(H,25,27)(H,26,28)(H,29,30); |
| InChIKey | HSMYKYFYYFTZTD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |