C38H42N2O5 — CID 6688027
N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6688027) has the molecular formula C38H42N2O5 and a molecular weight of 606.76 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6688027 |
| Molecular Formula | C38H42N2O5 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)c3ccccc3)cc2)O[C@H]1CN1CCC[C@H]1CO |
| InChI | InChI=1S/C38H42N2O5/c1-26-35(23-40-21-7-11-33(40)25-42)44-38(45-36(26)29-15-13-27(24-41)14-16-29)31-19-17-28(18-20-31)34-12-6-5-10-32(34)22-39-37(43)30-8-3-2-4-9-30/h2-6,8-10,12-20,26,33,35-36,38,41-42H,7,11,21-25H2,1H3,(H,39,43)/t26-,33+,35+,36?,38+/m1/s1 |
| InChIKey | YOTSBXVGTLDALK-LHHZBSOWSA-N |
| XLogP | 6.02 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |