C43H50N2O4 — CID 6690211
N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 6690211) has the molecular formula C43H50N2O4 and a molecular weight of 658.88 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 6690211 |
| Molecular Formula | C43H50N2O4 |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.38 |
| IUPAC Name | N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | C[C@@H]1[C@H](CN2CC3(C)CC2CC(C)(C)C3)O[C@H](c2ccc(-c3ccccc3CNC(=O)c3ccccc3)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C43H50N2O4/c1-29-38(25-45-28-43(4)23-36(45)22-42(2,3)27-43)48-41(49-39(29)32-16-14-30(26-46)15-17-32)34-20-18-31(19-21-34)37-13-9-8-12-35(37)24-44-40(47)33-10-6-5-7-11-33/h5-21,29,36,38-39,41,46H,22-28H2,1-4H3,(H,44,47)/t29-,36?,38+,39+,41+,43?/m1/s1 |
| InChIKey | SZICKTUOXKDCIZ-PKNHCJFHSA-N |
| XLogP | 8.47 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |