C35H43N3O4 — CID 6705663
N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide (PubChem CID 6705663) has the molecular formula C35H43N3O4 and a molecular weight of 569.75 g/mol. Its IUPAC name is N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6705663 |
| Molecular Formula | C35H43N3O4 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | N-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]pyridine-3-carboxamide |
| SMILES | C[C@@H]1[C@H](CN2CC3(C)CC2CC(C)(C)C3)O[C@H](c2ccc(NC(=O)c3cccnc3)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H43N3O4/c1-23-30(19-38-22-35(4)17-29(38)16-34(2,3)21-35)41-33(42-31(23)25-9-7-24(20-39)8-10-25)26-11-13-28(14-12-26)37-32(40)27-6-5-15-36-18-27/h5-15,18,23,29-31,33,39H,16-17,19-22H2,1-4H3,(H,37,40)/t23-,29?,30+,31+,33+,35?/m1/s1 |
| InChIKey | UDTXRFZBGIYJHG-LXTRZRRUSA-N |
| XLogP | 6.52 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |