C34H46N2O5 — CID 6684419
prop-2-enyl N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate (PubChem CID 6684419) has the molecular formula C34H46N2O5 and a molecular weight of 562.75 g/mol. Its IUPAC name is prop-2-enyl N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 6684419 |
| Molecular Formula | C34H46N2O5 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | prop-2-enyl N-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1ccc([C@@H]2O[C@H](CN3CC4(C)CC3CC(C)(C)C4)[C@H](C)[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C34H46N2O5/c1-6-15-39-32(38)35-18-24-7-13-27(14-8-24)31-40-29(19-36-22-34(5)17-28(36)16-33(3,4)21-34)23(2)30(41-31)26-11-9-25(20-37)10-12-26/h6-14,23,28-31,37H,1,15-22H2,2-5H3,(H,35,38)/t23-,28?,29+,30+,31+,34?/m0/s1 |
| InChIKey | CYAPKMNBOBRKEZ-OIHKGKQWSA-N |
| XLogP | 6.28 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|