C38H44N2O5 — CID 6690176
2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6690176) has the molecular formula C38H44N2O5 and a molecular weight of 608.78 g/mol. Its IUPAC name is 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6690176 |
| Molecular Formula | C38H44N2O5 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CN2CC3(C)CC2CC(C)(C)C3)O[C@H](c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C38H44N2O5/c1-24-32(20-39-23-38(4)18-29(39)17-37(2,3)22-38)44-36(45-33(24)27-13-11-26(21-41)12-14-27)28-15-9-25(10-16-28)19-40-34(42)30-7-5-6-8-31(30)35(40)43/h5-16,24,29,32-33,36,41H,17-23H2,1-4H3/t24-,29?,32+,33+,36+,38?/m1/s1 |
| InChIKey | XUAJTKNNBPLAEG-RWLQYFCZSA-N |
| XLogP | 6.67 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|