C38H48N2O4 — CID 6690219
N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6690219) has the molecular formula C38H48N2O4 and a molecular weight of 596.81 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6690219 |
| Molecular Formula | C38H48N2O4 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | N-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccccc1-c1ccc([C@H]2O[C@@H](CN3CC4(C)CC3CC(C)(C)C4)[C@@H](C)[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C38H48N2O4/c1-25-34(21-40-24-38(5)19-32(40)18-37(3,4)23-38)43-36(44-35(25)29-12-10-27(22-41)11-13-29)30-16-14-28(15-17-30)33-9-7-6-8-31(33)20-39-26(2)42/h6-17,25,32,34-36,41H,18-24H2,1-5H3,(H,39,42)/t25-,32?,34+,35+,36+,38?/m1/s1 |
| InChIKey | QYGSQZKNKQTRMA-DTBCGBEXSA-N |
| XLogP | 7.17 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |